About 6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 2763471) has the molecular formula C11H9N5
and a molecular weight of 211.23 g/mol. Its IUPAC name is 6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 2763471 |
| Molecular Formula | C11H9N5 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Nc1c(-c2ccccc2)cnc2ncnn12 |
| InChI | InChI=1S/C11H9N5/c12-10-9(8-4-2-1-3-5-8)6-13-11-14-7-15-16(10)11/h1-7H,12H2 |
| InChIKey | REBXMCHIFCICTM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (CID 2763471) is 6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine is Nc1c(-c2ccccc2)cnc2ncnn12.
What is the InChIKey of 6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is REBXMCHIFCICTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5/c12-10-9(8-4-2-1-3-5-8)6-13-11-14-7-15-16(10)11/h1-7H,12H2.
What are the key properties of 6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine?
6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 211.23 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 2763471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).