C12H11N3 — CID 2763483
5,6-dihydrobenzo[h]quinazolin-2-amine (PubChem CID 2763483) has the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. Its IUPAC name is 5,6-dihydrobenzo[h]quinazolin-2-amine.
| Compound Name | 5,6-dihydrobenzo[h]quinazolin-2-amine |
|---|---|
| PubChem CID | 2763483 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 5,6-dihydrobenzo[h]quinazolin-2-amine |
| SMILES | Nc1ncc2c(n1)-c1ccccc1CC2 |
| InChI | InChI=1S/C12H11N3/c13-12-14-7-9-6-5-8-3-1-2-4-10(8)11(9)15-12/h1-4,7H,5-6H2,(H2,13,14,15) |
| InChIKey | JBTKXKYATFWBAO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |