About 5-methyl-2-pyridin-3-yl-1,3-thiazol-4-ol
5-methyl-2-pyridin-3-yl-1,3-thiazol-4-ol (PubChem CID 2763637) has the molecular formula C9H8N2OS
and a molecular weight of 192.24 g/mol. Its IUPAC name is 5-methyl-2-pyridin-3-yl-1,3-thiazol-4-ol.
Molecular Properties
| Compound Name | 5-methyl-2-pyridin-3-yl-1,3-thiazol-4-ol |
| PubChem CID | 2763637 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 5-methyl-2-pyridin-3-yl-1,3-thiazol-4-ol |
| SMILES | Cc1sc(-c2cccnc2)nc1O |
| InChI | InChI=1S/C9H8N2OS/c1-6-8(12)11-9(13-6)7-3-2-4-10-5-7/h2-5,12H,1H3 |
| InChIKey | XJTFUXZJRDKVKA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-2-pyridin-3-yl-1,3-thiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-pyridin-3-yl-1,3-thiazol-4-ol?
The IUPAC name of 5-methyl-2-pyridin-3-yl-1,3-thiazol-4-ol (CID 2763637) is 5-methyl-2-pyridin-3-yl-1,3-thiazol-4-ol.
What is the SMILES notation for 5-methyl-2-pyridin-3-yl-1,3-thiazol-4-ol?
The canonical SMILES for 5-methyl-2-pyridin-3-yl-1,3-thiazol-4-ol is Cc1sc(-c2cccnc2)nc1O.
What is the InChIKey of 5-methyl-2-pyridin-3-yl-1,3-thiazol-4-ol?
The InChIKey is XJTFUXZJRDKVKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2OS/c1-6-8(12)11-9(13-6)7-3-2-4-10-5-7/h2-5,12H,1H3.
What are the key properties of 5-methyl-2-pyridin-3-yl-1,3-thiazol-4-ol?
5-methyl-2-pyridin-3-yl-1,3-thiazol-4-ol has a molecular weight of 192.24 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-pyridin-3-yl-1,3-thiazol-4-ol is sourced from PubChem (CID 2763637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).