C23H30N2O5S — CID 27637193
3,4-diethoxy-N-(1-propylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)benzamide (PubChem CID 27637193) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is 3,4-diethoxy-N-(1-propylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)benzamide.
| Compound Name | 3,4-diethoxy-N-(1-propylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)benzamide |
|---|---|
| PubChem CID | 27637193 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 3,4-diethoxy-N-(1-propylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)benzamide |
| SMILES | CCCS(=O)(=O)N1CCCc2cc(NC(=O)c3ccc(OCC)c(OCC)c3)ccc21 |
| InChI | InChI=1S/C23H30N2O5S/c1-4-14-31(27,28)25-13-7-8-17-15-19(10-11-20(17)25)24-23(26)18-9-12-21(29-5-2)22(16-18)30-6-3/h9-12,15-16H,4-8,13-14H2,1-3H3,(H,24,26) |
| InChIKey | IGPJFZUQJRALEK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |