1-(3,5-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid

C10H7Cl2N3O2 — CID 2763754

IUPAC1-(3,5-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid
SMILESCc1nc(C(=O)O)nn1-c1cc(Cl)cc(Cl)c1
InChIInChI=1S/C10H7Cl2N3O2/c1-5-13-9(10(16)17)14-15(5)8-3-6(11)2-7(12)4-8/h2-4H,1H3,(H,16,17)
InChIKeyCZTNDZALWLHXBA-UHFFFAOYSA-N
MW272.09 g/mol
LogP2.58
Rot. Bonds2

About 1-(3,5-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid

1-(3,5-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid (PubChem CID 2763754) has the molecular formula C10H7Cl2N3O2 and a molecular weight of 272.09 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid.

Molecular Properties

Compound Name1-(3,5-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid
PubChem CID2763754
Molecular FormulaC10H7Cl2N3O2
Molecular Weight272.09 g/mol
Exact Mass270.99
IUPAC Name1-(3,5-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid
SMILESCc1nc(C(=O)O)nn1-c1cc(Cl)cc(Cl)c1
InChIInChI=1S/C10H7Cl2N3O2/c1-5-13-9(10(16)17)14-15(5)8-3-6(11)2-7(12)4-8/h2-4H,1H3,(H,16,17)
InChIKeyCZTNDZALWLHXBA-UHFFFAOYSA-N
XLogP2.58
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.09
LogP ≤ 52.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-(3,5-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(3,5-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid?
The IUPAC name of 1-(3,5-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid (CID 2763754) is 1-(3,5-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid.
What is the SMILES notation for 1-(3,5-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid?
The canonical SMILES for 1-(3,5-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid is Cc1nc(C(=O)O)nn1-c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 1-(3,5-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid?
The InChIKey is CZTNDZALWLHXBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2N3O2/c1-5-13-9(10(16)17)14-15(5)8-3-6(11)2-7(12)4-8/h2-4H,1H3,(H,16,17).
What are the key properties of 1-(3,5-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid?
1-(3,5-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid has a molecular weight of 272.09 g/mol, XLogP of 2.58, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid is sourced from PubChem (CID 2763754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).