About [2-[(2,6-dichlorophenyl)methylsulfanyl]-3-methylimidazol-4-yl]methanol
[2-[(2,6-dichlorophenyl)methylsulfanyl]-3-methylimidazol-4-yl]methanol (PubChem CID 2763897) has the molecular formula C12H12Cl2N2OS
and a molecular weight of 303.21 g/mol. Its IUPAC name is [2-[(2,6-dichlorophenyl)methylsulfanyl]-3-methylimidazol-4-yl]methanol.
Molecular Properties
| Compound Name | [2-[(2,6-dichlorophenyl)methylsulfanyl]-3-methylimidazol-4-yl]methanol |
| PubChem CID | 2763897 |
| Molecular Formula | C12H12Cl2N2OS |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | [2-[(2,6-dichlorophenyl)methylsulfanyl]-3-methylimidazol-4-yl]methanol |
| SMILES | Cn1c(CO)cnc1SCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H12Cl2N2OS/c1-16-8(6-17)5-15-12(16)18-7-9-10(13)3-2-4-11(9)14/h2-5,17H,6-7H2,1H3 |
| InChIKey | LRSRCFMICRUHEH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(2,6-dichlorophenyl)methylsulfanyl]-3-methylimidazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,6-dichlorophenyl)methylsulfanyl]-3-methylimidazol-4-yl]methanol?
The IUPAC name of [2-[(2,6-dichlorophenyl)methylsulfanyl]-3-methylimidazol-4-yl]methanol (CID 2763897) is [2-[(2,6-dichlorophenyl)methylsulfanyl]-3-methylimidazol-4-yl]methanol.
What is the SMILES notation for [2-[(2,6-dichlorophenyl)methylsulfanyl]-3-methylimidazol-4-yl]methanol?
The canonical SMILES for [2-[(2,6-dichlorophenyl)methylsulfanyl]-3-methylimidazol-4-yl]methanol is Cn1c(CO)cnc1SCc1c(Cl)cccc1Cl.
What is the InChIKey of [2-[(2,6-dichlorophenyl)methylsulfanyl]-3-methylimidazol-4-yl]methanol?
The InChIKey is LRSRCFMICRUHEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2N2OS/c1-16-8(6-17)5-15-12(16)18-7-9-10(13)3-2-4-11(9)14/h2-5,17H,6-7H2,1H3.
What are the key properties of [2-[(2,6-dichlorophenyl)methylsulfanyl]-3-methylimidazol-4-yl]methanol?
[2-[(2,6-dichlorophenyl)methylsulfanyl]-3-methylimidazol-4-yl]methanol has a molecular weight of 303.21 g/mol, XLogP of 3.51, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,6-dichlorophenyl)methylsulfanyl]-3-methylimidazol-4-yl]methanol is sourced from PubChem (CID 2763897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).