C12H14F2N2O2S — CID 27640774
2-(2,4-difluorophenyl)sulfanyl-N-(propylcarbamoyl)acetamide (PubChem CID 27640774) has the molecular formula C12H14F2N2O2S and a molecular weight of 288.32 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfanyl-N-(propylcarbamoyl)acetamide.
| Compound Name | 2-(2,4-difluorophenyl)sulfanyl-N-(propylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 27640774 |
| Molecular Formula | C12H14F2N2O2S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfanyl-N-(propylcarbamoyl)acetamide |
| SMILES | CCCNC(=O)NC(=O)CSc1ccc(F)cc1F |
| InChI | InChI=1S/C12H14F2N2O2S/c1-2-5-15-12(18)16-11(17)7-19-10-4-3-8(13)6-9(10)14/h3-4,6H,2,5,7H2,1H3,(H2,15,16,17,18) |
| InChIKey | JZFRNNPAOXZFCS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |