About 3-(2-bromopropan-2-yl)-1,5-dihydro-2,4-benzodioxepine
3-(2-bromopropan-2-yl)-1,5-dihydro-2,4-benzodioxepine (PubChem CID 2764101) has the molecular formula C12H15BrO2
and a molecular weight of 271.15 g/mol. Its IUPAC name is 3-(2-bromopropan-2-yl)-1,5-dihydro-2,4-benzodioxepine.
Molecular Properties
| Compound Name | 3-(2-bromopropan-2-yl)-1,5-dihydro-2,4-benzodioxepine |
| PubChem CID | 2764101 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 3-(2-bromopropan-2-yl)-1,5-dihydro-2,4-benzodioxepine |
| SMILES | CC(C)(Br)C1OCc2ccccc2CO1 |
| InChI | InChI=1S/C12H15BrO2/c1-12(2,13)11-14-7-9-5-3-4-6-10(9)8-15-11/h3-6,11H,7-8H2,1-2H3 |
| InChIKey | YINPGRQOGVQJIL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-bromopropan-2-yl)-1,5-dihydro-2,4-benzodioxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromopropan-2-yl)-1,5-dihydro-2,4-benzodioxepine?
The IUPAC name of 3-(2-bromopropan-2-yl)-1,5-dihydro-2,4-benzodioxepine (CID 2764101) is 3-(2-bromopropan-2-yl)-1,5-dihydro-2,4-benzodioxepine.
What is the SMILES notation for 3-(2-bromopropan-2-yl)-1,5-dihydro-2,4-benzodioxepine?
The canonical SMILES for 3-(2-bromopropan-2-yl)-1,5-dihydro-2,4-benzodioxepine is CC(C)(Br)C1OCc2ccccc2CO1.
What is the InChIKey of 3-(2-bromopropan-2-yl)-1,5-dihydro-2,4-benzodioxepine?
The InChIKey is YINPGRQOGVQJIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrO2/c1-12(2,13)11-14-7-9-5-3-4-6-10(9)8-15-11/h3-6,11H,7-8H2,1-2H3.
What are the key properties of 3-(2-bromopropan-2-yl)-1,5-dihydro-2,4-benzodioxepine?
3-(2-bromopropan-2-yl)-1,5-dihydro-2,4-benzodioxepine has a molecular weight of 271.15 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromopropan-2-yl)-1,5-dihydro-2,4-benzodioxepine is sourced from PubChem (CID 2764101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).