About 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]phenol
4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]phenol (PubChem CID 2764216) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]phenol.
Molecular Properties
| Compound Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]phenol |
| PubChem CID | 2764216 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]phenol |
| SMILES | Cc1noc(C)c1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C12H13NO2/c1-8-12(9(2)15-13-8)7-10-3-5-11(14)6-4-10/h3-6,14H,7H2,1-2H3 |
| InChIKey | JIQYQBSFMDEVIJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]phenol?
The IUPAC name of 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]phenol (CID 2764216) is 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]phenol.
What is the SMILES notation for 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]phenol?
The canonical SMILES for 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]phenol is Cc1noc(C)c1Cc1ccc(O)cc1.
What is the InChIKey of 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]phenol?
The InChIKey is JIQYQBSFMDEVIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-8-12(9(2)15-13-8)7-10-3-5-11(14)6-4-10/h3-6,14H,7H2,1-2H3.
What are the key properties of 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]phenol?
4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]phenol has a molecular weight of 203.24 g/mol, XLogP of 2.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]phenol is sourced from PubChem (CID 2764216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).