C13H10ClNO3 — CID 2764223
1-[(2-chlorophenyl)methyl]-6-oxopyridine-3-carboxylic acid (PubChem CID 2764223) has the molecular formula C13H10ClNO3 and a molecular weight of 263.68 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-6-oxopyridine-3-carboxylic acid.
| Compound Name | 1-[(2-chlorophenyl)methyl]-6-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 2764223 |
| Molecular Formula | C13H10ClNO3 |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-6-oxopyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(=O)n(Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C13H10ClNO3/c14-11-4-2-1-3-9(11)7-15-8-10(13(17)18)5-6-12(15)16/h1-6,8H,7H2,(H,17,18) |
| InChIKey | UTHKVSFOOCIQAL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |