About imidazo[1,2-a]pyridin-8-ol
imidazo[1,2-a]pyridin-8-ol (PubChem CID 2764453) has the molecular formula C7H6N2O
and a molecular weight of 134.14 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-8-ol.
Molecular Properties
| Compound Name | imidazo[1,2-a]pyridin-8-ol |
| PubChem CID | 2764453 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | imidazo[1,2-a]pyridin-8-ol |
| SMILES | Oc1cccn2ccnc12 |
| InChI | InChI=1S/C7H6N2O/c10-6-2-1-4-9-5-3-8-7(6)9/h1-5,10H |
| InChIKey | VPUDIWIKGNMSOL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze imidazo[1,2-a]pyridin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,2-a]pyridin-8-ol?
The IUPAC name of imidazo[1,2-a]pyridin-8-ol (CID 2764453) is imidazo[1,2-a]pyridin-8-ol.
What is the SMILES notation for imidazo[1,2-a]pyridin-8-ol?
The canonical SMILES for imidazo[1,2-a]pyridin-8-ol is Oc1cccn2ccnc12.
What is the InChIKey of imidazo[1,2-a]pyridin-8-ol?
The InChIKey is VPUDIWIKGNMSOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O/c10-6-2-1-4-9-5-3-8-7(6)9/h1-5,10H.
What are the key properties of imidazo[1,2-a]pyridin-8-ol?
imidazo[1,2-a]pyridin-8-ol has a molecular weight of 134.14 g/mol, XLogP of 1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-a]pyridin-8-ol is sourced from PubChem (CID 2764453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).