About 6-amino-4-methyl-1,4-benzoxazin-3-one
6-amino-4-methyl-1,4-benzoxazin-3-one (PubChem CID 2764463) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 6-amino-4-methyl-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-amino-4-methyl-1,4-benzoxazin-3-one |
| PubChem CID | 2764463 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 6-amino-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)COc2ccc(N)cc21 |
| InChI | InChI=1S/C9H10N2O2/c1-11-7-4-6(10)2-3-8(7)13-5-9(11)12/h2-4H,5,10H2,1H3 |
| InChIKey | QXLKSGOSLHFMIU-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-4-methyl-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-4-methyl-1,4-benzoxazin-3-one?
The IUPAC name of 6-amino-4-methyl-1,4-benzoxazin-3-one (CID 2764463) is 6-amino-4-methyl-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-amino-4-methyl-1,4-benzoxazin-3-one?
The canonical SMILES for 6-amino-4-methyl-1,4-benzoxazin-3-one is CN1C(=O)COc2ccc(N)cc21.
What is the InChIKey of 6-amino-4-methyl-1,4-benzoxazin-3-one?
The InChIKey is QXLKSGOSLHFMIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-11-7-4-6(10)2-3-8(7)13-5-9(11)12/h2-4H,5,10H2,1H3.
What are the key properties of 6-amino-4-methyl-1,4-benzoxazin-3-one?
6-amino-4-methyl-1,4-benzoxazin-3-one has a molecular weight of 178.19 g/mol, XLogP of 0.62, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4-methyl-1,4-benzoxazin-3-one is sourced from PubChem (CID 2764463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).