C23H27N3O3S — CID 27644813
N-[2-(1H-indol-3-yl)ethyl]-4-(4-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 27644813) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-4-(4-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-4-(4-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 27644813 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-4-(4-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(C(=O)NCCc3c[nH]c4ccccc34)cc2)CC1 |
| InChI | InChI=1S/C23H27N3O3S/c1-17-11-14-26(15-12-17)30(28,29)20-8-6-18(7-9-20)23(27)24-13-10-19-16-25-22-5-3-2-4-21(19)22/h2-9,16-17,25H,10-15H2,1H3,(H,24,27) |
| InChIKey | ZEUVGCKJHXETJN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |