C7H13N3O2S — CID 2764646
3-(2,2-dimethoxyethyl)-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 2764646) has the molecular formula C7H13N3O2S and a molecular weight of 203.27 g/mol. Its IUPAC name is 3-(2,2-dimethoxyethyl)-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2,2-dimethoxyethyl)-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 2764646 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 3-(2,2-dimethoxyethyl)-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | COC(Cc1n[nH]c(=S)n1C)OC |
| InChI | InChI=1S/C7H13N3O2S/c1-10-5(8-9-7(10)13)4-6(11-2)12-3/h6H,4H2,1-3H3,(H,9,13) |
| InChIKey | QFVMPPYORXPGQI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|