About [[anilino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]amino]methylidene-dimethylazanium
[[anilino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]amino]methylidene-dimethylazanium (PubChem CID 2764720) has the molecular formula C17H18Cl2N3S+
and a molecular weight of 367.33 g/mol. Its IUPAC name is [[anilino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]amino]methylidene-dimethylazanium.
Molecular Properties
| Compound Name | [[anilino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]amino]methylidene-dimethylazanium |
| PubChem CID | 2764720 |
| Molecular Formula | C17H18Cl2N3S+ |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | [[anilino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]amino]methylidene-dimethylazanium |
| SMILES | C[N+](C)=C/N=C(/Nc1ccccc1)SCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H17Cl2N3S/c1-22(2)12-20-17(21-13-7-4-3-5-8-13)23-11-14-15(18)9-6-10-16(14)19/h3-10,12H,11H2,1-2H3/p+1 |
| InChIKey | ASRKZOUNGQQGMC-UHFFFAOYSA-O |
| XLogP | 5.00 |
| TPSA | 27.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [[anilino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]amino]methylidene-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[anilino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]amino]methylidene-dimethylazanium?
The IUPAC name of [[anilino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]amino]methylidene-dimethylazanium (CID 2764720) is [[anilino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]amino]methylidene-dimethylazanium.
What is the SMILES notation for [[anilino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]amino]methylidene-dimethylazanium?
The canonical SMILES for [[anilino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]amino]methylidene-dimethylazanium is C[N+](C)=C/N=C(/Nc1ccccc1)SCc1c(Cl)cccc1Cl.
What is the InChIKey of [[anilino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]amino]methylidene-dimethylazanium?
The InChIKey is ASRKZOUNGQQGMC-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H17Cl2N3S/c1-22(2)12-20-17(21-13-7-4-3-5-8-13)23-11-14-15(18)9-6-10-16(14)19/h3-10,12H,11H2,1-2H3/p+1.
What are the key properties of [[anilino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]amino]methylidene-dimethylazanium?
[[anilino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]amino]methylidene-dimethylazanium has a molecular weight of 367.33 g/mol, XLogP of 5.00, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [[anilino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]amino]methylidene-dimethylazanium is sourced from PubChem (CID 2764720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).