About 1-[(3,4-difluorophenyl)methyl]-6-oxopyridine-3-carboxamide
1-[(3,4-difluorophenyl)methyl]-6-oxopyridine-3-carboxamide (PubChem CID 2764874) has the molecular formula C13H10F2N2O2
and a molecular weight of 264.23 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-6-oxopyridine-3-carboxamide.
Molecular Properties
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-6-oxopyridine-3-carboxamide |
| PubChem CID | 2764874 |
| Molecular Formula | C13H10F2N2O2 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-6-oxopyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(=O)n(Cc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C13H10F2N2O2/c14-10-3-1-8(5-11(10)15)6-17-7-9(13(16)19)2-4-12(17)18/h1-5,7H,6H2,(H2,16,19) |
| InChIKey | YLGHTWPQHBGBJX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3,4-difluorophenyl)methyl]-6-oxopyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-difluorophenyl)methyl]-6-oxopyridine-3-carboxamide?
The IUPAC name of 1-[(3,4-difluorophenyl)methyl]-6-oxopyridine-3-carboxamide (CID 2764874) is 1-[(3,4-difluorophenyl)methyl]-6-oxopyridine-3-carboxamide.
What is the SMILES notation for 1-[(3,4-difluorophenyl)methyl]-6-oxopyridine-3-carboxamide?
The canonical SMILES for 1-[(3,4-difluorophenyl)methyl]-6-oxopyridine-3-carboxamide is NC(=O)c1ccc(=O)n(Cc2ccc(F)c(F)c2)c1.
What is the InChIKey of 1-[(3,4-difluorophenyl)methyl]-6-oxopyridine-3-carboxamide?
The InChIKey is YLGHTWPQHBGBJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F2N2O2/c14-10-3-1-8(5-11(10)15)6-17-7-9(13(16)19)2-4-12(17)18/h1-5,7H,6H2,(H2,16,19).
What are the key properties of 1-[(3,4-difluorophenyl)methyl]-6-oxopyridine-3-carboxamide?
1-[(3,4-difluorophenyl)methyl]-6-oxopyridine-3-carboxamide has a molecular weight of 264.23 g/mol, XLogP of 1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-difluorophenyl)methyl]-6-oxopyridine-3-carboxamide is sourced from PubChem (CID 2764874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).