C16H13F3N4OS — CID 2764882
3-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyridin-2-one (PubChem CID 2764882) has the molecular formula C16H13F3N4OS and a molecular weight of 366.37 g/mol. Its IUPAC name is 3-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyridin-2-one.
| Compound Name | 3-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyridin-2-one |
|---|---|
| PubChem CID | 2764882 |
| Molecular Formula | C16H13F3N4OS |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 3-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyridin-2-one |
| SMILES | Cn1c(-c2cccn(Cc3cccc(C(F)(F)F)c3)c2=O)n[nH]c1=S |
| InChI | InChI=1S/C16H13F3N4OS/c1-22-13(20-21-15(22)25)12-6-3-7-23(14(12)24)9-10-4-2-5-11(8-10)16(17,18)19/h2-8H,9H2,1H3,(H,21,25) |
| InChIKey | GLPBRURHADWSPB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|