C17H14Cl2N4OS — CID 2764893
1-[(2,4-dichlorophenyl)methyl]-3-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)pyridin-2-one (PubChem CID 2764893) has the molecular formula C17H14Cl2N4OS and a molecular weight of 393.30 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)pyridin-2-one.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)pyridin-2-one |
|---|---|
| PubChem CID | 2764893 |
| Molecular Formula | C17H14Cl2N4OS |
| Molecular Weight | 393.30 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)pyridin-2-one |
| SMILES | C=CCn1c(-c2cccn(Cc3ccc(Cl)cc3Cl)c2=O)n[nH]c1=S |
| InChI | InChI=1S/C17H14Cl2N4OS/c1-2-7-23-15(20-21-17(23)25)13-4-3-8-22(16(13)24)10-11-5-6-12(18)9-14(11)19/h2-6,8-9H,1,7,10H2,(H,21,25) |
| InChIKey | KUNZSKMULZUYQP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|