About 3-[(3,4-dichlorophenyl)methylsulfanyl]thiophene-2-carboxylic acid
3-[(3,4-dichlorophenyl)methylsulfanyl]thiophene-2-carboxylic acid (PubChem CID 2765033) has the molecular formula C12H8Cl2O2S2
and a molecular weight of 319.23 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methylsulfanyl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-[(3,4-dichlorophenyl)methylsulfanyl]thiophene-2-carboxylic acid |
| PubChem CID | 2765033 |
| Molecular Formula | C12H8Cl2O2S2 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methylsulfanyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1SCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H8Cl2O2S2/c13-8-2-1-7(5-9(8)14)6-18-10-3-4-17-11(10)12(15)16/h1-5H,6H2,(H,15,16) |
| InChIKey | UCHDVTOVFHVWOS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3,4-dichlorophenyl)methylsulfanyl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,4-dichlorophenyl)methylsulfanyl]thiophene-2-carboxylic acid?
The IUPAC name of 3-[(3,4-dichlorophenyl)methylsulfanyl]thiophene-2-carboxylic acid (CID 2765033) is 3-[(3,4-dichlorophenyl)methylsulfanyl]thiophene-2-carboxylic acid.
What is the SMILES notation for 3-[(3,4-dichlorophenyl)methylsulfanyl]thiophene-2-carboxylic acid?
The canonical SMILES for 3-[(3,4-dichlorophenyl)methylsulfanyl]thiophene-2-carboxylic acid is O=C(O)c1sccc1SCc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-[(3,4-dichlorophenyl)methylsulfanyl]thiophene-2-carboxylic acid?
The InChIKey is UCHDVTOVFHVWOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2O2S2/c13-8-2-1-7(5-9(8)14)6-18-10-3-4-17-11(10)12(15)16/h1-5H,6H2,(H,15,16).
What are the key properties of 3-[(3,4-dichlorophenyl)methylsulfanyl]thiophene-2-carboxylic acid?
3-[(3,4-dichlorophenyl)methylsulfanyl]thiophene-2-carboxylic acid has a molecular weight of 319.23 g/mol, XLogP of 5.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-dichlorophenyl)methylsulfanyl]thiophene-2-carboxylic acid is sourced from PubChem (CID 2765033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).