About 2-(4-bromophenyl)sulfanyl-1,1-diphenylethanol
2-(4-bromophenyl)sulfanyl-1,1-diphenylethanol (PubChem CID 2765149) has the molecular formula C20H17BrOS
and a molecular weight of 385.33 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-1,1-diphenylethanol.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)sulfanyl-1,1-diphenylethanol |
| PubChem CID | 2765149 |
| Molecular Formula | C20H17BrOS |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-1,1-diphenylethanol |
| SMILES | OC(CSc1ccc(Br)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H17BrOS/c21-18-11-13-19(14-12-18)23-15-20(22,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14,22H,15H2 |
| InChIKey | UZARFOHRHVNQSJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-bromophenyl)sulfanyl-1,1-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)sulfanyl-1,1-diphenylethanol?
The IUPAC name of 2-(4-bromophenyl)sulfanyl-1,1-diphenylethanol (CID 2765149) is 2-(4-bromophenyl)sulfanyl-1,1-diphenylethanol.
What is the SMILES notation for 2-(4-bromophenyl)sulfanyl-1,1-diphenylethanol?
The canonical SMILES for 2-(4-bromophenyl)sulfanyl-1,1-diphenylethanol is OC(CSc1ccc(Br)cc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(4-bromophenyl)sulfanyl-1,1-diphenylethanol?
The InChIKey is UZARFOHRHVNQSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17BrOS/c21-18-11-13-19(14-12-18)23-15-20(22,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14,22H,15H2.
What are the key properties of 2-(4-bromophenyl)sulfanyl-1,1-diphenylethanol?
2-(4-bromophenyl)sulfanyl-1,1-diphenylethanol has a molecular weight of 385.33 g/mol, XLogP of 5.48, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)sulfanyl-1,1-diphenylethanol is sourced from PubChem (CID 2765149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).