About 2-benzylsulfinyl-1,1-diphenylethanol
2-benzylsulfinyl-1,1-diphenylethanol (PubChem CID 2765160) has the molecular formula C21H20O2S
and a molecular weight of 336.46 g/mol. Its IUPAC name is 2-benzylsulfinyl-1,1-diphenylethanol.
Molecular Properties
| Compound Name | 2-benzylsulfinyl-1,1-diphenylethanol |
| PubChem CID | 2765160 |
| Molecular Formula | C21H20O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-benzylsulfinyl-1,1-diphenylethanol |
| SMILES | O=S(Cc1ccccc1)CC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20O2S/c22-21(19-12-6-2-7-13-19,20-14-8-3-9-15-20)17-24(23)16-18-10-4-1-5-11-18/h1-15,22H,16-17H2 |
| InChIKey | YYBQGBXESZEJMS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzylsulfinyl-1,1-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfinyl-1,1-diphenylethanol?
The IUPAC name of 2-benzylsulfinyl-1,1-diphenylethanol (CID 2765160) is 2-benzylsulfinyl-1,1-diphenylethanol.
What is the SMILES notation for 2-benzylsulfinyl-1,1-diphenylethanol?
The canonical SMILES for 2-benzylsulfinyl-1,1-diphenylethanol is O=S(Cc1ccccc1)CC(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-benzylsulfinyl-1,1-diphenylethanol?
The InChIKey is YYBQGBXESZEJMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20O2S/c22-21(19-12-6-2-7-13-19,20-14-8-3-9-15-20)17-24(23)16-18-10-4-1-5-11-18/h1-15,22H,16-17H2.
What are the key properties of 2-benzylsulfinyl-1,1-diphenylethanol?
2-benzylsulfinyl-1,1-diphenylethanol has a molecular weight of 336.46 g/mol, XLogP of 3.87, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfinyl-1,1-diphenylethanol is sourced from PubChem (CID 2765160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).