About 2-[(4-chlorophenyl)methylsulfinyl]-1,1-diphenylethanol
2-[(4-chlorophenyl)methylsulfinyl]-1,1-diphenylethanol (PubChem CID 2765169) has the molecular formula C21H19ClO2S
and a molecular weight of 370.90 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfinyl]-1,1-diphenylethanol.
Molecular Properties
| Compound Name | 2-[(4-chlorophenyl)methylsulfinyl]-1,1-diphenylethanol |
| PubChem CID | 2765169 |
| Molecular Formula | C21H19ClO2S |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfinyl]-1,1-diphenylethanol |
| SMILES | O=S(Cc1ccc(Cl)cc1)CC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19ClO2S/c22-20-13-11-17(12-14-20)15-25(24)16-21(23,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-14,23H,15-16H2 |
| InChIKey | CYSLJWHMRDKNBJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(4-chlorophenyl)methylsulfinyl]-1,1-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chlorophenyl)methylsulfinyl]-1,1-diphenylethanol?
The IUPAC name of 2-[(4-chlorophenyl)methylsulfinyl]-1,1-diphenylethanol (CID 2765169) is 2-[(4-chlorophenyl)methylsulfinyl]-1,1-diphenylethanol.
What is the SMILES notation for 2-[(4-chlorophenyl)methylsulfinyl]-1,1-diphenylethanol?
The canonical SMILES for 2-[(4-chlorophenyl)methylsulfinyl]-1,1-diphenylethanol is O=S(Cc1ccc(Cl)cc1)CC(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-[(4-chlorophenyl)methylsulfinyl]-1,1-diphenylethanol?
The InChIKey is CYSLJWHMRDKNBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19ClO2S/c22-20-13-11-17(12-14-20)15-25(24)16-21(23,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-14,23H,15-16H2.
What are the key properties of 2-[(4-chlorophenyl)methylsulfinyl]-1,1-diphenylethanol?
2-[(4-chlorophenyl)methylsulfinyl]-1,1-diphenylethanol has a molecular weight of 370.90 g/mol, XLogP of 4.52, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chlorophenyl)methylsulfinyl]-1,1-diphenylethanol is sourced from PubChem (CID 2765169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).