About 2-benzylsulfinyl-1,1-bis(4-chlorophenyl)ethanol
2-benzylsulfinyl-1,1-bis(4-chlorophenyl)ethanol (PubChem CID 2765180) has the molecular formula C21H18Cl2O2S
and a molecular weight of 405.35 g/mol. Its IUPAC name is 2-benzylsulfinyl-1,1-bis(4-chlorophenyl)ethanol.
Molecular Properties
| Compound Name | 2-benzylsulfinyl-1,1-bis(4-chlorophenyl)ethanol |
| PubChem CID | 2765180 |
| Molecular Formula | C21H18Cl2O2S |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 2-benzylsulfinyl-1,1-bis(4-chlorophenyl)ethanol |
| SMILES | O=S(Cc1ccccc1)CC(O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18Cl2O2S/c22-19-10-6-17(7-11-19)21(24,18-8-12-20(23)13-9-18)15-26(25)14-16-4-2-1-3-5-16/h1-13,24H,14-15H2 |
| InChIKey | GJYABQOTGJEBQU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzylsulfinyl-1,1-bis(4-chlorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfinyl-1,1-bis(4-chlorophenyl)ethanol?
The IUPAC name of 2-benzylsulfinyl-1,1-bis(4-chlorophenyl)ethanol (CID 2765180) is 2-benzylsulfinyl-1,1-bis(4-chlorophenyl)ethanol.
What is the SMILES notation for 2-benzylsulfinyl-1,1-bis(4-chlorophenyl)ethanol?
The canonical SMILES for 2-benzylsulfinyl-1,1-bis(4-chlorophenyl)ethanol is O=S(Cc1ccccc1)CC(O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1.
What is the InChIKey of 2-benzylsulfinyl-1,1-bis(4-chlorophenyl)ethanol?
The InChIKey is GJYABQOTGJEBQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18Cl2O2S/c22-19-10-6-17(7-11-19)21(24,18-8-12-20(23)13-9-18)15-26(25)14-16-4-2-1-3-5-16/h1-13,24H,14-15H2.
What are the key properties of 2-benzylsulfinyl-1,1-bis(4-chlorophenyl)ethanol?
2-benzylsulfinyl-1,1-bis(4-chlorophenyl)ethanol has a molecular weight of 405.35 g/mol, XLogP of 5.18, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfinyl-1,1-bis(4-chlorophenyl)ethanol is sourced from PubChem (CID 2765180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).