C20H23ClN4O5 — CID 27651938
3-(4-chlorophenyl)-N-(2,2-diethoxyethyl)-5-methyl-2,4-dioxo-1H-pyrrolo[3,2-d]pyrimidine-7-carboxamide (PubChem CID 27651938) has the molecular formula C20H23ClN4O5 and a molecular weight of 434.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(2,2-diethoxyethyl)-5-methyl-2,4-dioxo-1H-pyrrolo[3,2-d]pyrimidine-7-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-(2,2-diethoxyethyl)-5-methyl-2,4-dioxo-1H-pyrrolo[3,2-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 27651938 |
| Molecular Formula | C20H23ClN4O5 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(2,2-diethoxyethyl)-5-methyl-2,4-dioxo-1H-pyrrolo[3,2-d]pyrimidine-7-carboxamide |
| SMILES | CCOC(CNC(=O)c1cn(C)c2c(=O)n(-c3ccc(Cl)cc3)c(=O)[nH]c12)OCC |
| InChI | InChI=1S/C20H23ClN4O5/c1-4-29-15(30-5-2)10-22-18(26)14-11-24(3)17-16(14)23-20(28)25(19(17)27)13-8-6-12(21)7-9-13/h6-9,11,15H,4-5,10H2,1-3H3,(H,22,26)(H,23,28) |
| InChIKey | NMSAWXKDQMKZPE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|