C16H11Cl2NO3S — CID 2765202
2,4-bis(4-chlorophenyl)-1-oxo-1,4-thiazinane-3,5-dione (PubChem CID 2765202) has the molecular formula C16H11Cl2NO3S and a molecular weight of 368.24 g/mol. Its IUPAC name is 2,4-bis(4-chlorophenyl)-1-oxo-1,4-thiazinane-3,5-dione.
| Compound Name | 2,4-bis(4-chlorophenyl)-1-oxo-1,4-thiazinane-3,5-dione |
|---|---|
| PubChem CID | 2765202 |
| Molecular Formula | C16H11Cl2NO3S |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | 2,4-bis(4-chlorophenyl)-1-oxo-1,4-thiazinane-3,5-dione |
| SMILES | O=C1CS(=O)C(c2ccc(Cl)cc2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11Cl2NO3S/c17-11-3-1-10(2-4-11)15-16(21)19(14(20)9-23(15)22)13-7-5-12(18)6-8-13/h1-8,15H,9H2 |
| InChIKey | UOHXQBPQDDPQCN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|