About Diethyl butylidenepropanedioate
Diethyl butylidenepropanedioate (PubChem CID 276528) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is diethyl 2-butylidenepropanedioate.
Molecular Properties
| Compound Name | Diethyl butylidenepropanedioate |
| PubChem CID | 276528 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | diethyl 2-butylidenepropanedioate |
| SMILES | CCCC=C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C11H18O4/c1-4-7-8-9(10(12)14-5-2)11(13)15-6-3/h8H,4-7H2,1-3H3 |
| InChIKey | HMTIRFYNPBFXRM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | 223 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze Diethyl butylidenepropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Diethyl butylidenepropanedioate?
The IUPAC name of Diethyl butylidenepropanedioate (CID 276528) is diethyl 2-butylidenepropanedioate.
What is the SMILES notation for Diethyl butylidenepropanedioate?
The canonical SMILES for Diethyl butylidenepropanedioate is CCCC=C(C(=O)OCC)C(=O)OCC.
What is the InChIKey of Diethyl butylidenepropanedioate?
The InChIKey is HMTIRFYNPBFXRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4/c1-4-7-8-9(10(12)14-5-2)11(13)15-6-3/h8H,4-7H2,1-3H3.
What are the key properties of Diethyl butylidenepropanedioate?
Diethyl butylidenepropanedioate has a molecular weight of 214.26 g/mol, XLogP of 2.70, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Diethyl butylidenepropanedioate is sourced from PubChem (CID 276528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).