C21H17ClF3N7O4 — CID 2765348
5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-(3-methyl-5-oxo-1-phenyl-1,2,4-triazolidin-3-yl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 2765348) has the molecular formula C21H17ClF3N7O4 and a molecular weight of 523.86 g/mol. Its IUPAC name is 5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-(3-methyl-5-oxo-1-phenyl-1,2,4-triazolidin-3-yl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-(3-methyl-5-oxo-1-phenyl-1,2,4-triazolidin-3-yl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 2765348 |
| Molecular Formula | C21H17ClF3N7O4 |
| Molecular Weight | 523.86 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | 5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-(3-methyl-5-oxo-1-phenyl-1,2,4-triazolidin-3-yl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CN(c1ncc(C(F)(F)F)cc1Cl)N1C(=O)C2ON=C(C3(C)NC(=O)N(c4ccccc4)N3)C2C1=O |
| InChI | InChI=1S/C21H17ClF3N7O4/c1-20(27-19(35)31(29-20)11-6-4-3-5-7-11)15-13-14(36-28-15)18(34)32(17(13)33)30(2)16-12(22)8-10(9-26-16)21(23,24)25/h3-9,13-14,29H,1-2H3,(H,27,35) |
| InChIKey | IACLZCGNMWEOQR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.86 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|