C18H19BrN2O3S — CID 27656057
3-bromo-N-(1-ethylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)benzamide (PubChem CID 27656057) has the molecular formula C18H19BrN2O3S and a molecular weight of 423.33 g/mol. Its IUPAC name is 3-bromo-N-(1-ethylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)benzamide.
| Compound Name | 3-bromo-N-(1-ethylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 27656057 |
| Molecular Formula | C18H19BrN2O3S |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 3-bromo-N-(1-ethylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)benzamide |
| SMILES | CCS(=O)(=O)N1CCCc2ccc(NC(=O)c3cccc(Br)c3)cc21 |
| InChI | InChI=1S/C18H19BrN2O3S/c1-2-25(23,24)21-10-4-6-13-8-9-16(12-17(13)21)20-18(22)14-5-3-7-15(19)11-14/h3,5,7-9,11-12H,2,4,6,10H2,1H3,(H,20,22) |
| InChIKey | HFZNDQYLLGXPIS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |