About ethyl 5-[(2,4-dichlorophenyl)methoxyimino]-2-[(4-fluorophenyl)methyl]-3-oxopentanoate
ethyl 5-[(2,4-dichlorophenyl)methoxyimino]-2-[(4-fluorophenyl)methyl]-3-oxopentanoate (PubChem CID 2765816) has the molecular formula C21H20Cl2FNO4
and a molecular weight of 440.30 g/mol. Its IUPAC name is ethyl 5-[(2,4-dichlorophenyl)methoxyimino]-2-[(4-fluorophenyl)methyl]-3-oxopentanoate.
Molecular Properties
| Compound Name | ethyl 5-[(2,4-dichlorophenyl)methoxyimino]-2-[(4-fluorophenyl)methyl]-3-oxopentanoate |
| PubChem CID | 2765816 |
| Molecular Formula | C21H20Cl2FNO4 |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | ethyl 5-[(2,4-dichlorophenyl)methoxyimino]-2-[(4-fluorophenyl)methyl]-3-oxopentanoate |
| SMILES | CCOC(=O)C(Cc1ccc(F)cc1)C(=O)CC=NOCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H20Cl2FNO4/c1-2-28-21(27)18(11-14-3-7-17(24)8-4-14)20(26)9-10-25-29-13-15-5-6-16(22)12-19(15)23/h3-8,10,12,18H,2,9,11,13H2,1H3 |
| InChIKey | MDFJEMXDADDZCP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-[(2,4-dichlorophenyl)methoxyimino]-2-[(4-fluorophenyl)methyl]-3-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(2,4-dichlorophenyl)methoxyimino]-2-[(4-fluorophenyl)methyl]-3-oxopentanoate?
The IUPAC name of ethyl 5-[(2,4-dichlorophenyl)methoxyimino]-2-[(4-fluorophenyl)methyl]-3-oxopentanoate (CID 2765816) is ethyl 5-[(2,4-dichlorophenyl)methoxyimino]-2-[(4-fluorophenyl)methyl]-3-oxopentanoate.
What is the SMILES notation for ethyl 5-[(2,4-dichlorophenyl)methoxyimino]-2-[(4-fluorophenyl)methyl]-3-oxopentanoate?
The canonical SMILES for ethyl 5-[(2,4-dichlorophenyl)methoxyimino]-2-[(4-fluorophenyl)methyl]-3-oxopentanoate is CCOC(=O)C(Cc1ccc(F)cc1)C(=O)CC=NOCc1ccc(Cl)cc1Cl.
What is the InChIKey of ethyl 5-[(2,4-dichlorophenyl)methoxyimino]-2-[(4-fluorophenyl)methyl]-3-oxopentanoate?
The InChIKey is MDFJEMXDADDZCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20Cl2FNO4/c1-2-28-21(27)18(11-14-3-7-17(24)8-4-14)20(26)9-10-25-29-13-15-5-6-16(22)12-19(15)23/h3-8,10,12,18H,2,9,11,13H2,1H3.
What are the key properties of ethyl 5-[(2,4-dichlorophenyl)methoxyimino]-2-[(4-fluorophenyl)methyl]-3-oxopentanoate?
ethyl 5-[(2,4-dichlorophenyl)methoxyimino]-2-[(4-fluorophenyl)methyl]-3-oxopentanoate has a molecular weight of 440.30 g/mol, XLogP of 5.02, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(2,4-dichlorophenyl)methoxyimino]-2-[(4-fluorophenyl)methyl]-3-oxopentanoate is sourced from PubChem (CID 2765816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).