C21H32N2O3S — CID 27658984
azepan-1-yl-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-4-yl]methanone (PubChem CID 27658984) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is azepan-1-yl-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-4-yl]methanone |
|---|---|
| PubChem CID | 27658984 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | azepan-1-yl-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-4-yl]methanone |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCC(C(=O)N3CCCCCC3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H32N2O3S/c1-16-14-17(2)20(18(3)15-16)27(25,26)23-12-8-19(9-13-23)21(24)22-10-6-4-5-7-11-22/h14-15,19H,4-13H2,1-3H3 |
| InChIKey | RIUAUXKLIMWVNZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |