C18H17N3O — CID 27660239
1-phenyl-N-[(1S)-1-phenylethyl]pyrazole-4-carboxamide (PubChem CID 27660239) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-phenyl-N-[(1S)-1-phenylethyl]pyrazole-4-carboxamide.
| Compound Name | 1-phenyl-N-[(1S)-1-phenylethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 27660239 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-phenyl-N-[(1S)-1-phenylethyl]pyrazole-4-carboxamide |
| SMILES | C[C@H](NC(=O)c1cnn(-c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C18H17N3O/c1-14(15-8-4-2-5-9-15)20-18(22)16-12-19-21(13-16)17-10-6-3-7-11-17/h2-14H,1H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | IGTPGJYYYNBORT-AWEZNQCLSA-N |
| XLogP | 3.36 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |