2-amino-3-cyclohexa-2,5-dien-1-ylpropanoic acid

C9H13NO2 — CID 27662

IUPAC2-amino-3-cyclohexa-2,5-dien-1-ylpropanoic acid
SMILESNC(CC1C=CCC=C1)C(=O)O
InChIInChI=1S/C9H13NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h2-5,7-8H,1,6,10H2,(H,11,12)
InChIKeyIZKPUUZAGQLNCR-UHFFFAOYSA-N
MW167.21 g/mol
LogP0.92
Rot. Bonds3

About 2-amino-3-cyclohexa-2,5-dien-1-ylpropanoic acid

2-amino-3-cyclohexa-2,5-dien-1-ylpropanoic acid (PubChem CID 27662) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-amino-3-cyclohexa-2,5-dien-1-ylpropanoic acid.

Molecular Properties

Compound Name2-amino-3-cyclohexa-2,5-dien-1-ylpropanoic acid
PubChem CID27662
Molecular FormulaC9H13NO2
Molecular Weight167.21 g/mol
Exact Mass167.09
IUPAC Name2-amino-3-cyclohexa-2,5-dien-1-ylpropanoic acid
SMILESNC(CC1C=CCC=C1)C(=O)O
InChIInChI=1S/C9H13NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h2-5,7-8H,1,6,10H2,(H,11,12)
InChIKeyIZKPUUZAGQLNCR-UHFFFAOYSA-N
XLogP0.92
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500167.21
LogP ≤ 50.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-amino-3-cyclohexa-2,5-dien-1-ylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-cyclohexa-2,5-dien-1-ylpropanoic acid?
The IUPAC name of 2-amino-3-cyclohexa-2,5-dien-1-ylpropanoic acid (CID 27662) is 2-amino-3-cyclohexa-2,5-dien-1-ylpropanoic acid.
What is the SMILES notation for 2-amino-3-cyclohexa-2,5-dien-1-ylpropanoic acid?
The canonical SMILES for 2-amino-3-cyclohexa-2,5-dien-1-ylpropanoic acid is NC(CC1C=CCC=C1)C(=O)O.
What is the InChIKey of 2-amino-3-cyclohexa-2,5-dien-1-ylpropanoic acid?
The InChIKey is IZKPUUZAGQLNCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h2-5,7-8H,1,6,10H2,(H,11,12).
What are the key properties of 2-amino-3-cyclohexa-2,5-dien-1-ylpropanoic acid?
2-amino-3-cyclohexa-2,5-dien-1-ylpropanoic acid has a molecular weight of 167.21 g/mol, XLogP of 0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-cyclohexa-2,5-dien-1-ylpropanoic acid is sourced from PubChem (CID 27662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).