About 2-(4-methoxyphenyl)-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide
2-(4-methoxyphenyl)-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 27662197) has the molecular formula C17H14N4O3S
and a molecular weight of 354.39 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide.
Molecular Properties
| Compound Name | 2-(4-methoxyphenyl)-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide |
| PubChem CID | 27662197 |
| Molecular Formula | C17H14N4O3S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 2-(4-methoxyphenyl)-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | COc1ccc(-c2nc(C(=O)NNC(=O)c3ccccn3)cs2)cc1 |
| InChI | InChI=1S/C17H14N4O3S/c1-24-12-7-5-11(6-8-12)17-19-14(10-25-17)16(23)21-20-15(22)13-4-2-3-9-18-13/h2-10H,1H3,(H,20,22)(H,21,23) |
| InChIKey | OXEAWFDPMOXIFR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methoxyphenyl)-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenyl)-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide?
The IUPAC name of 2-(4-methoxyphenyl)-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide (CID 27662197) is 2-(4-methoxyphenyl)-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide.
What is the SMILES notation for 2-(4-methoxyphenyl)-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide?
The canonical SMILES for 2-(4-methoxyphenyl)-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide is COc1ccc(-c2nc(C(=O)NNC(=O)c3ccccn3)cs2)cc1.
What is the InChIKey of 2-(4-methoxyphenyl)-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide?
The InChIKey is OXEAWFDPMOXIFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4O3S/c1-24-12-7-5-11(6-8-12)17-19-14(10-25-17)16(23)21-20-15(22)13-4-2-3-9-18-13/h2-10H,1H3,(H,20,22)(H,21,23).
What are the key properties of 2-(4-methoxyphenyl)-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide?
2-(4-methoxyphenyl)-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide has a molecular weight of 354.39 g/mol, XLogP of 2.29, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenyl)-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide is sourced from PubChem (CID 27662197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).