About 5-(6-chloro-3-pyridinyl)-1,3-oxazole
5-(6-chloro-3-pyridinyl)-1,3-oxazole (PubChem CID 2766284) has the molecular formula C8H5ClN2O
and a molecular weight of 180.59 g/mol. Its IUPAC name is 5-(6-chloro-3-pyridinyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 5-(6-chloro-3-pyridinyl)-1,3-oxazole |
| PubChem CID | 2766284 |
| Molecular Formula | C8H5ClN2O |
| Molecular Weight | 180.59 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | 5-(6-chloro-3-pyridinyl)-1,3-oxazole |
| SMILES | Clc1ccc(-c2cnco2)cn1 |
| InChI | InChI=1S/C8H5ClN2O/c9-8-2-1-6(3-11-8)7-4-10-5-12-7/h1-5H |
| InChIKey | VLCZGHUOVFKECA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.59 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-(6-chloro-3-pyridinyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-chloro-3-pyridinyl)-1,3-oxazole?
The IUPAC name of 5-(6-chloro-3-pyridinyl)-1,3-oxazole (CID 2766284) is 5-(6-chloro-3-pyridinyl)-1,3-oxazole.
What is the SMILES notation for 5-(6-chloro-3-pyridinyl)-1,3-oxazole?
The canonical SMILES for 5-(6-chloro-3-pyridinyl)-1,3-oxazole is Clc1ccc(-c2cnco2)cn1.
What is the InChIKey of 5-(6-chloro-3-pyridinyl)-1,3-oxazole?
The InChIKey is VLCZGHUOVFKECA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN2O/c9-8-2-1-6(3-11-8)7-4-10-5-12-7/h1-5H.
What are the key properties of 5-(6-chloro-3-pyridinyl)-1,3-oxazole?
5-(6-chloro-3-pyridinyl)-1,3-oxazole has a molecular weight of 180.59 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-chloro-3-pyridinyl)-1,3-oxazole is sourced from PubChem (CID 2766284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).