About trimethyl(phenyl)azanium bromide
trimethyl(phenyl)azanium bromide (PubChem CID 27663) has the molecular formula C9H14BrN
and a molecular weight of 216.12 g/mol. Its IUPAC name is trimethyl(phenyl)azanium bromide.
Molecular Properties
| Compound Name | trimethyl(phenyl)azanium bromide |
| PubChem CID | 27663 |
| Molecular Formula | C9H14BrN |
| Molecular Weight | 216.12 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | trimethyl(phenyl)azanium bromide |
| SMILES | C[N+](C)(C)c1ccccc1.[Br-] |
| InChI | InChI=1S/C9H14N.BrH/c1-10(2,3)9-7-5-4-6-8-9;/h4-8H,1-3H3;1H/q+1;/p-1 |
| InChIKey | GNMJFQWRASXXMS-UHFFFAOYSA-M |
| XLogP | -1.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.12 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(phenyl)azanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(phenyl)azanium bromide?
The IUPAC name of trimethyl(phenyl)azanium bromide (CID 27663) is trimethyl(phenyl)azanium bromide.
What is the SMILES notation for trimethyl(phenyl)azanium bromide?
The canonical SMILES for trimethyl(phenyl)azanium bromide is C[N+](C)(C)c1ccccc1.[Br-].
What is the InChIKey of trimethyl(phenyl)azanium bromide?
The InChIKey is GNMJFQWRASXXMS-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H14N.BrH/c1-10(2,3)9-7-5-4-6-8-9;/h4-8H,1-3H3;1H/q+1;/p-1.
What are the key properties of trimethyl(phenyl)azanium bromide?
trimethyl(phenyl)azanium bromide has a molecular weight of 216.12 g/mol, XLogP of -1.11, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(phenyl)azanium bromide is sourced from PubChem (CID 27663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).