About 7-(4-fluorophenoxy)-2,4-bis(trifluoromethyl)-1,8-naphthyridine
7-(4-fluorophenoxy)-2,4-bis(trifluoromethyl)-1,8-naphthyridine (PubChem CID 2766503) has the molecular formula C16H7F7N2O
and a molecular weight of 376.23 g/mol. Its IUPAC name is 7-(4-fluorophenoxy)-2,4-bis(trifluoromethyl)-1,8-naphthyridine.
Molecular Properties
| Compound Name | 7-(4-fluorophenoxy)-2,4-bis(trifluoromethyl)-1,8-naphthyridine |
| PubChem CID | 2766503 |
| Molecular Formula | C16H7F7N2O |
| Molecular Weight | 376.23 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 7-(4-fluorophenoxy)-2,4-bis(trifluoromethyl)-1,8-naphthyridine |
| SMILES | Fc1ccc(Oc2ccc3c(C(F)(F)F)cc(C(F)(F)F)nc3n2)cc1 |
| InChI | InChI=1S/C16H7F7N2O/c17-8-1-3-9(4-2-8)26-13-6-5-10-11(15(18,19)20)7-12(16(21,22)23)24-14(10)25-13/h1-7H |
| InChIKey | LROYSHLQXUBFSF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.23 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(4-fluorophenoxy)-2,4-bis(trifluoromethyl)-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-fluorophenoxy)-2,4-bis(trifluoromethyl)-1,8-naphthyridine?
The IUPAC name of 7-(4-fluorophenoxy)-2,4-bis(trifluoromethyl)-1,8-naphthyridine (CID 2766503) is 7-(4-fluorophenoxy)-2,4-bis(trifluoromethyl)-1,8-naphthyridine.
What is the SMILES notation for 7-(4-fluorophenoxy)-2,4-bis(trifluoromethyl)-1,8-naphthyridine?
The canonical SMILES for 7-(4-fluorophenoxy)-2,4-bis(trifluoromethyl)-1,8-naphthyridine is Fc1ccc(Oc2ccc3c(C(F)(F)F)cc(C(F)(F)F)nc3n2)cc1.
What is the InChIKey of 7-(4-fluorophenoxy)-2,4-bis(trifluoromethyl)-1,8-naphthyridine?
The InChIKey is LROYSHLQXUBFSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H7F7N2O/c17-8-1-3-9(4-2-8)26-13-6-5-10-11(15(18,19)20)7-12(16(21,22)23)24-14(10)25-13/h1-7H.
What are the key properties of 7-(4-fluorophenoxy)-2,4-bis(trifluoromethyl)-1,8-naphthyridine?
7-(4-fluorophenoxy)-2,4-bis(trifluoromethyl)-1,8-naphthyridine has a molecular weight of 376.23 g/mol, XLogP of 5.60, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-fluorophenoxy)-2,4-bis(trifluoromethyl)-1,8-naphthyridine is sourced from PubChem (CID 2766503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).