About 3-[(2,4-dichlorophenyl)methoxyimino]-1-[[3-(trifluoromethyl)phenyl]methyl]indol-2-one
3-[(2,4-dichlorophenyl)methoxyimino]-1-[[3-(trifluoromethyl)phenyl]methyl]indol-2-one (PubChem CID 2766665) has the molecular formula C23H15Cl2F3N2O2
and a molecular weight of 479.29 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methoxyimino]-1-[[3-(trifluoromethyl)phenyl]methyl]indol-2-one.
Molecular Properties
| Compound Name | 3-[(2,4-dichlorophenyl)methoxyimino]-1-[[3-(trifluoromethyl)phenyl]methyl]indol-2-one |
| PubChem CID | 2766665 |
| Molecular Formula | C23H15Cl2F3N2O2 |
| Molecular Weight | 479.29 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methoxyimino]-1-[[3-(trifluoromethyl)phenyl]methyl]indol-2-one |
| SMILES | O=C1C(=NOCc2ccc(Cl)cc2Cl)c2ccccc2N1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H15Cl2F3N2O2/c24-17-9-8-15(19(25)11-17)13-32-29-21-18-6-1-2-7-20(18)30(22(21)31)12-14-4-3-5-16(10-14)23(26,27)28/h1-11H,12-13H2 |
| InChIKey | PFOYZIQWJDLLAG-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.29 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,4-dichlorophenyl)methoxyimino]-1-[[3-(trifluoromethyl)phenyl]methyl]indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4-dichlorophenyl)methoxyimino]-1-[[3-(trifluoromethyl)phenyl]methyl]indol-2-one?
The IUPAC name of 3-[(2,4-dichlorophenyl)methoxyimino]-1-[[3-(trifluoromethyl)phenyl]methyl]indol-2-one (CID 2766665) is 3-[(2,4-dichlorophenyl)methoxyimino]-1-[[3-(trifluoromethyl)phenyl]methyl]indol-2-one.
What is the SMILES notation for 3-[(2,4-dichlorophenyl)methoxyimino]-1-[[3-(trifluoromethyl)phenyl]methyl]indol-2-one?
The canonical SMILES for 3-[(2,4-dichlorophenyl)methoxyimino]-1-[[3-(trifluoromethyl)phenyl]methyl]indol-2-one is O=C1C(=NOCc2ccc(Cl)cc2Cl)c2ccccc2N1Cc1cccc(C(F)(F)F)c1.
What is the InChIKey of 3-[(2,4-dichlorophenyl)methoxyimino]-1-[[3-(trifluoromethyl)phenyl]methyl]indol-2-one?
The InChIKey is PFOYZIQWJDLLAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15Cl2F3N2O2/c24-17-9-8-15(19(25)11-17)13-32-29-21-18-6-1-2-7-20(18)30(22(21)31)12-14-4-3-5-16(10-14)23(26,27)28/h1-11H,12-13H2.
What are the key properties of 3-[(2,4-dichlorophenyl)methoxyimino]-1-[[3-(trifluoromethyl)phenyl]methyl]indol-2-one?
3-[(2,4-dichlorophenyl)methoxyimino]-1-[[3-(trifluoromethyl)phenyl]methyl]indol-2-one has a molecular weight of 479.29 g/mol, XLogP of 6.48, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-dichlorophenyl)methoxyimino]-1-[[3-(trifluoromethyl)phenyl]methyl]indol-2-one is sourced from PubChem (CID 2766665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).