About 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide
1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide (PubChem CID 2766696) has the molecular formula C6H10N4O2
and a molecular weight of 170.17 g/mol. Its IUPAC name is 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide.
Molecular Properties
| Compound Name | 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide |
| PubChem CID | 2766696 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide |
| SMILES | [H]/N=C(\N)C1CN(C)C(=O)NC1=O |
| InChI | InChI=1S/C6H10N4O2/c1-10-2-3(4(7)8)5(11)9-6(10)12/h3H,2H2,1H3,(H3,7,8)(H,9,11,12) |
| InChIKey | IXPNQXFRVYWDDI-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide?
The IUPAC name of 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide (CID 2766696) is 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide.
What is the SMILES notation for 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide?
The canonical SMILES for 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide is [H]/N=C(\N)C1CN(C)C(=O)NC1=O.
What is the InChIKey of 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide?
The InChIKey is IXPNQXFRVYWDDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O2/c1-10-2-3(4(7)8)5(11)9-6(10)12/h3H,2H2,1H3,(H3,7,8)(H,9,11,12).
What are the key properties of 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide?
1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide has a molecular weight of 170.17 g/mol, XLogP of -1.28, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide is sourced from PubChem (CID 2766696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).