About 1-(4-acetylphenyl)-2,4-dioxopyrimidine-5-carbonitrile
1-(4-acetylphenyl)-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 2766715) has the molecular formula C13H9N3O3
and a molecular weight of 255.23 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-2,4-dioxopyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 1-(4-acetylphenyl)-2,4-dioxopyrimidine-5-carbonitrile |
| PubChem CID | 2766715 |
| Molecular Formula | C13H9N3O3 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 1-(4-acetylphenyl)-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | CC(=O)c1ccc(-n2cc(C#N)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C13H9N3O3/c1-8(17)9-2-4-11(5-3-9)16-7-10(6-14)12(18)15-13(16)19/h2-5,7H,1H3,(H,15,18,19) |
| InChIKey | NJKLSJSKSFMMGK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-acetylphenyl)-2,4-dioxopyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-acetylphenyl)-2,4-dioxopyrimidine-5-carbonitrile?
The IUPAC name of 1-(4-acetylphenyl)-2,4-dioxopyrimidine-5-carbonitrile (CID 2766715) is 1-(4-acetylphenyl)-2,4-dioxopyrimidine-5-carbonitrile.
What is the SMILES notation for 1-(4-acetylphenyl)-2,4-dioxopyrimidine-5-carbonitrile?
The canonical SMILES for 1-(4-acetylphenyl)-2,4-dioxopyrimidine-5-carbonitrile is CC(=O)c1ccc(-n2cc(C#N)c(=O)[nH]c2=O)cc1.
What is the InChIKey of 1-(4-acetylphenyl)-2,4-dioxopyrimidine-5-carbonitrile?
The InChIKey is NJKLSJSKSFMMGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O3/c1-8(17)9-2-4-11(5-3-9)16-7-10(6-14)12(18)15-13(16)19/h2-5,7H,1H3,(H,15,18,19).
What are the key properties of 1-(4-acetylphenyl)-2,4-dioxopyrimidine-5-carbonitrile?
1-(4-acetylphenyl)-2,4-dioxopyrimidine-5-carbonitrile has a molecular weight of 255.23 g/mol, XLogP of 0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-acetylphenyl)-2,4-dioxopyrimidine-5-carbonitrile is sourced from PubChem (CID 2766715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).