2-(2-phenyl-1,3-thiazol-4-yl)benzoic acid

C16H11NO2S — CID 2766882

IUPAC2-(2-phenyl-1,3-thiazol-4-yl)benzoic acid
SMILESO=C(O)c1ccccc1-c1csc(-c2ccccc2)n1
InChIInChI=1S/C16H11NO2S/c18-16(19)13-9-5-4-8-12(13)14-10-20-15(17-14)11-6-2-1-3-7-11/h1-10H,(H,18,19)
InChIKeyKJTDLBFUDMTJMD-UHFFFAOYSA-N
MW281.34 g/mol
LogP4.18
Rot. Bonds3

About 2-(2-phenyl-1,3-thiazol-4-yl)benzoic acid

2-(2-phenyl-1,3-thiazol-4-yl)benzoic acid (PubChem CID 2766882) has the molecular formula C16H11NO2S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-(2-phenyl-1,3-thiazol-4-yl)benzoic acid.

Molecular Properties

Compound Name2-(2-phenyl-1,3-thiazol-4-yl)benzoic acid
PubChem CID2766882
Molecular FormulaC16H11NO2S
Molecular Weight281.34 g/mol
Exact Mass281.05
IUPAC Name2-(2-phenyl-1,3-thiazol-4-yl)benzoic acid
SMILESO=C(O)c1ccccc1-c1csc(-c2ccccc2)n1
InChIInChI=1S/C16H11NO2S/c18-16(19)13-9-5-4-8-12(13)14-10-20-15(17-14)11-6-2-1-3-7-11/h1-10H,(H,18,19)
InChIKeyKJTDLBFUDMTJMD-UHFFFAOYSA-N
XLogP4.18
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.34
LogP ≤ 54.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2-phenyl-1,3-thiazol-4-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-phenyl-1,3-thiazol-4-yl)benzoic acid?
The IUPAC name of 2-(2-phenyl-1,3-thiazol-4-yl)benzoic acid (CID 2766882) is 2-(2-phenyl-1,3-thiazol-4-yl)benzoic acid.
What is the SMILES notation for 2-(2-phenyl-1,3-thiazol-4-yl)benzoic acid?
The canonical SMILES for 2-(2-phenyl-1,3-thiazol-4-yl)benzoic acid is O=C(O)c1ccccc1-c1csc(-c2ccccc2)n1.
What is the InChIKey of 2-(2-phenyl-1,3-thiazol-4-yl)benzoic acid?
The InChIKey is KJTDLBFUDMTJMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO2S/c18-16(19)13-9-5-4-8-12(13)14-10-20-15(17-14)11-6-2-1-3-7-11/h1-10H,(H,18,19).
What are the key properties of 2-(2-phenyl-1,3-thiazol-4-yl)benzoic acid?
2-(2-phenyl-1,3-thiazol-4-yl)benzoic acid has a molecular weight of 281.34 g/mol, XLogP of 4.18, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenyl-1,3-thiazol-4-yl)benzoic acid is sourced from PubChem (CID 2766882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).