About S-(4-methylphenyl) N-methylcarbamothioate
S-(4-methylphenyl) N-methylcarbamothioate (PubChem CID 27669) has the molecular formula C9H11NOS
and a molecular weight of 181.26 g/mol. Its IUPAC name is S-(4-methylphenyl) N-methylcarbamothioate.
Molecular Properties
| Compound Name | S-(4-methylphenyl) N-methylcarbamothioate |
| PubChem CID | 27669 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | S-(4-methylphenyl) N-methylcarbamothioate |
| SMILES | CNC(=O)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C9H11NOS/c1-7-3-5-8(6-4-7)12-9(11)10-2/h3-6H,1-2H3,(H,10,11) |
| InChIKey | QGAUXQOYLNHWDG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-methylphenyl) N-methylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-methylphenyl) N-methylcarbamothioate?
The IUPAC name of S-(4-methylphenyl) N-methylcarbamothioate (CID 27669) is S-(4-methylphenyl) N-methylcarbamothioate.
What is the SMILES notation for S-(4-methylphenyl) N-methylcarbamothioate?
The canonical SMILES for S-(4-methylphenyl) N-methylcarbamothioate is CNC(=O)Sc1ccc(C)cc1.
What is the InChIKey of S-(4-methylphenyl) N-methylcarbamothioate?
The InChIKey is QGAUXQOYLNHWDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NOS/c1-7-3-5-8(6-4-7)12-9(11)10-2/h3-6H,1-2H3,(H,10,11).
What are the key properties of S-(4-methylphenyl) N-methylcarbamothioate?
S-(4-methylphenyl) N-methylcarbamothioate has a molecular weight of 181.26 g/mol, XLogP of 2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-methylphenyl) N-methylcarbamothioate is sourced from PubChem (CID 27669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).