C20H24N2O3S — CID 27670732
3-(benzenesulfonamido)-N-cyclohexyl-N-methylbenzamide (PubChem CID 27670732) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-cyclohexyl-N-methylbenzamide.
| Compound Name | 3-(benzenesulfonamido)-N-cyclohexyl-N-methylbenzamide |
|---|---|
| PubChem CID | 27670732 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 3-(benzenesulfonamido)-N-cyclohexyl-N-methylbenzamide |
| SMILES | CN(C(=O)c1cccc(NS(=O)(=O)c2ccccc2)c1)C1CCCCC1 |
| InChI | InChI=1S/C20H24N2O3S/c1-22(18-11-4-2-5-12-18)20(23)16-9-8-10-17(15-16)21-26(24,25)19-13-6-3-7-14-19/h3,6-10,13-15,18,21H,2,4-5,11-12H2,1H3 |
| InChIKey | NWFULGFJFDFPHJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |