About N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine
N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine (PubChem CID 2767079) has the molecular formula C8H9ClF3N3
and a molecular weight of 239.63 g/mol. Its IUPAC name is N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine |
| PubChem CID | 2767079 |
| Molecular Formula | C8H9ClF3N3 |
| Molecular Weight | 239.63 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine |
| SMILES | NCCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C8H9ClF3N3/c9-6-3-5(8(10,11)12)4-15-7(6)14-2-1-13/h3-4H,1-2,13H2,(H,14,15) |
| InChIKey | QNCJTOXEHSOJAM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.63 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine?
The IUPAC name of N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine (CID 2767079) is N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine.
What is the SMILES notation for N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine?
The canonical SMILES for N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine is NCCNc1ncc(C(F)(F)F)cc1Cl.
What is the InChIKey of N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine?
The InChIKey is QNCJTOXEHSOJAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClF3N3/c9-6-3-5(8(10,11)12)4-15-7(6)14-2-1-13/h3-4H,1-2,13H2,(H,14,15).
What are the key properties of N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine?
N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine has a molecular weight of 239.63 g/mol, XLogP of 2.12, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine is sourced from PubChem (CID 2767079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).