C13H13ClN2 — CID 2767228
3-(4-chlorophenyl)-4,5,6,7-tetrahydro-1H-indazole (PubChem CID 2767228) has the molecular formula C13H13ClN2 and a molecular weight of 232.71 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4,5,6,7-tetrahydro-1H-indazole.
| Compound Name | 3-(4-chlorophenyl)-4,5,6,7-tetrahydro-1H-indazole |
|---|---|
| PubChem CID | 2767228 |
| Molecular Formula | C13H13ClN2 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 3-(4-chlorophenyl)-4,5,6,7-tetrahydro-1H-indazole |
| SMILES | Clc1ccc(-c2n[nH]c3c2CCCC3)cc1 |
| InChI | InChI=1S/C13H13ClN2/c14-10-7-5-9(6-8-10)13-11-3-1-2-4-12(11)15-16-13/h5-8H,1-4H2,(H,15,16) |
| InChIKey | KVEOBXMMMLVLKY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |