C15H15ClF3N5O3 — CID 2767259
(5Z)-1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5-(dimethylaminomethylidene)-1,3-diazinane-2,4,6-trione (PubChem CID 2767259) has the molecular formula C15H15ClF3N5O3 and a molecular weight of 405.76 g/mol. Its IUPAC name is (5Z)-1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5-(dimethylaminomethylidene)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5-(dimethylaminomethylidene)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2767259 |
| Molecular Formula | C15H15ClF3N5O3 |
| Molecular Weight | 405.76 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | (5Z)-1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5-(dimethylaminomethylidene)-1,3-diazinane-2,4,6-trione |
| SMILES | CN(C)/C=C1/C(=O)NC(=O)N(CCNc2ncc(C(F)(F)F)cc2Cl)C1=O |
| InChI | InChI=1S/C15H15ClF3N5O3/c1-23(2)7-9-12(25)22-14(27)24(13(9)26)4-3-20-11-10(16)5-8(6-21-11)15(17,18)19/h5-7H,3-4H2,1-2H3,(H,20,21)(H,22,25,27)/b9-7- |
| InChIKey | OLZHOSMVHYABCE-CLFYSBASSA-N |
| XLogP | 1.69 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.76 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|