C12H8Cl2N2O5 — CID 2767613
2-[3-[(2,4-dichlorophenyl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetic acid (PubChem CID 2767613) has the molecular formula C12H8Cl2N2O5 and a molecular weight of 331.11 g/mol. Its IUPAC name is 2-[3-[(2,4-dichlorophenyl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetic acid.
| Compound Name | 2-[3-[(2,4-dichlorophenyl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 2767613 |
| Molecular Formula | C12H8Cl2N2O5 |
| Molecular Weight | 331.11 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 2-[3-[(2,4-dichlorophenyl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C(=O)N(Cc2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C12H8Cl2N2O5/c13-7-2-1-6(8(14)3-7)4-15-10(19)11(20)16(12(15)21)5-9(17)18/h1-3H,4-5H2,(H,17,18) |
| InChIKey | QWXSGSDKGGYSSJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.11 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|