C13H9F3N2O5 — CID 2767618
2-[2,4,5-trioxo-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-1-yl]acetic acid (PubChem CID 2767618) has the molecular formula C13H9F3N2O5 and a molecular weight of 330.22 g/mol. Its IUPAC name is 2-[2,4,5-trioxo-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-1-yl]acetic acid.
| Compound Name | 2-[2,4,5-trioxo-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 2767618 |
| Molecular Formula | C13H9F3N2O5 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-[2,4,5-trioxo-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C(=O)N(Cc2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C13H9F3N2O5/c14-13(15,16)8-3-1-7(2-4-8)5-17-10(21)11(22)18(12(17)23)6-9(19)20/h1-4H,5-6H2,(H,19,20) |
| InChIKey | ORMFFSSNUMDTBO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|