C23H28F2N2O6S — CID 27676789
[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-(3,4,5-triethoxyphenyl)methanone (PubChem CID 27676789) has the molecular formula C23H28F2N2O6S and a molecular weight of 498.55 g/mol. Its IUPAC name is [4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-(3,4,5-triethoxyphenyl)methanone.
| Compound Name | [4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-(3,4,5-triethoxyphenyl)methanone |
|---|---|
| PubChem CID | 27676789 |
| Molecular Formula | C23H28F2N2O6S |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | [4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-(3,4,5-triethoxyphenyl)methanone |
| SMILES | CCOc1cc(C(=O)N2CCN(S(=O)(=O)c3ccc(F)cc3F)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H28F2N2O6S/c1-4-31-19-13-16(14-20(32-5-2)22(19)33-6-3)23(28)26-9-11-27(12-10-26)34(29,30)21-8-7-17(24)15-18(21)25/h7-8,13-15H,4-6,9-12H2,1-3H3 |
| InChIKey | XEAOSCYTAWWRHL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |