About 7-chloro-3,5-dihydro-2H-1,5-benzothiazepine-4-thione
7-chloro-3,5-dihydro-2H-1,5-benzothiazepine-4-thione (PubChem CID 2767694) has the molecular formula C9H8ClNS2
and a molecular weight of 229.76 g/mol. Its IUPAC name is 7-chloro-3,5-dihydro-2H-1,5-benzothiazepine-4-thione.
Molecular Properties
| Compound Name | 7-chloro-3,5-dihydro-2H-1,5-benzothiazepine-4-thione |
| PubChem CID | 2767694 |
| Molecular Formula | C9H8ClNS2 |
| Molecular Weight | 229.76 g/mol |
| Exact Mass | 228.98 |
| IUPAC Name | 7-chloro-3,5-dihydro-2H-1,5-benzothiazepine-4-thione |
| SMILES | S=C1CCSc2ccc(Cl)cc2N1 |
| InChI | InChI=1S/C9H8ClNS2/c10-6-1-2-8-7(5-6)11-9(12)3-4-13-8/h1-2,5H,3-4H2,(H,11,12) |
| InChIKey | JOUFDADZNMTYPZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.76 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-3,5-dihydro-2H-1,5-benzothiazepine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3,5-dihydro-2H-1,5-benzothiazepine-4-thione?
The IUPAC name of 7-chloro-3,5-dihydro-2H-1,5-benzothiazepine-4-thione (CID 2767694) is 7-chloro-3,5-dihydro-2H-1,5-benzothiazepine-4-thione.
What is the SMILES notation for 7-chloro-3,5-dihydro-2H-1,5-benzothiazepine-4-thione?
The canonical SMILES for 7-chloro-3,5-dihydro-2H-1,5-benzothiazepine-4-thione is S=C1CCSc2ccc(Cl)cc2N1.
What is the InChIKey of 7-chloro-3,5-dihydro-2H-1,5-benzothiazepine-4-thione?
The InChIKey is JOUFDADZNMTYPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNS2/c10-6-1-2-8-7(5-6)11-9(12)3-4-13-8/h1-2,5H,3-4H2,(H,11,12).
What are the key properties of 7-chloro-3,5-dihydro-2H-1,5-benzothiazepine-4-thione?
7-chloro-3,5-dihydro-2H-1,5-benzothiazepine-4-thione has a molecular weight of 229.76 g/mol, XLogP of 3.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3,5-dihydro-2H-1,5-benzothiazepine-4-thione is sourced from PubChem (CID 2767694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).