About 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-dimethylbenzamide
3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-dimethylbenzamide (PubChem CID 27678343) has the molecular formula C18H20N2O3S
and a molecular weight of 344.44 g/mol. Its IUPAC name is 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-dimethylbenzamide |
| PubChem CID | 27678343 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(S(=O)(=O)N2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C18H20N2O3S/c1-19(2)18(21)15-8-5-9-17(12-15)24(22,23)20-11-10-14-6-3-4-7-16(14)13-20/h3-9,12H,10-11,13H2,1-2H3 |
| InChIKey | UKXCJUUDEWXLRU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-dimethylbenzamide?
The IUPAC name of 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-dimethylbenzamide (CID 27678343) is 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-dimethylbenzamide.
What is the SMILES notation for 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-dimethylbenzamide?
The canonical SMILES for 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-dimethylbenzamide is CN(C)C(=O)c1cccc(S(=O)(=O)N2CCc3ccccc3C2)c1.
What is the InChIKey of 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-dimethylbenzamide?
The InChIKey is UKXCJUUDEWXLRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O3S/c1-19(2)18(21)15-8-5-9-17(12-15)24(22,23)20-11-10-14-6-3-4-7-16(14)13-20/h3-9,12H,10-11,13H2,1-2H3.
What are the key properties of 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-dimethylbenzamide?
3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-dimethylbenzamide has a molecular weight of 344.44 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N,N-dimethylbenzamide is sourced from PubChem (CID 27678343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).